C21H16N4O2S2 — CID 17121089
2-(1,3-benzothiazol-2-yl)-6-[(4-methylphenyl)sulfanylmethyl]-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 17121089) has the molecular formula C21H16N4O2S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-6-[(4-methylphenyl)sulfanylmethyl]-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-6-[(4-methylphenyl)sulfanylmethyl]-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 17121089 |
| Molecular Formula | C21H16N4O2S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-6-[(4-methylphenyl)sulfanylmethyl]-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | Cc1ccc(SCc2cc(=O)c3c(=O)n(-c4nc5ccccc5s4)[nH]c3[nH]2)cc1 |
| InChI | InChI=1S/C21H16N4O2S2/c1-12-6-8-14(9-7-12)28-11-13-10-16(26)18-19(22-13)24-25(20(18)27)21-23-15-4-2-3-5-17(15)29-21/h2-10H,11H2,1H3,(H2,22,24,26) |
| InChIKey | OMRBXQBMWOHYCR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|