C26H19N3O3S2 — CID 5203900
4-(1,3-benzodioxol-5-ylmethylidene)-2-(1,3-benzothiazol-2-yl)-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one (PubChem CID 5203900) has the molecular formula C26H19N3O3S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylidene)-2-(1,3-benzothiazol-2-yl)-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethylidene)-2-(1,3-benzothiazol-2-yl)-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one |
|---|---|
| PubChem CID | 5203900 |
| Molecular Formula | C26H19N3O3S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethylidene)-2-(1,3-benzothiazol-2-yl)-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one |
| SMILES | Cc1ccc(SCC2=NN(c3nc4ccccc4s3)C(=O)C2=Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C26H19N3O3S2/c1-16-6-9-18(10-7-16)33-14-21-19(12-17-8-11-22-23(13-17)32-15-31-22)25(30)29(28-21)26-27-20-4-2-3-5-24(20)34-26/h2-13H,14-15H2,1H3 |
| InChIKey | IJHKGGZXMPJDPK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|