C25H20N2O3 — CID 15951221
(4Z)-5-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-phenylpyrazol-3-one (PubChem CID 15951221) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is (4Z)-5-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-5-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 15951221 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (4Z)-5-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-phenylpyrazol-3-one |
| SMILES | O=C1/C(=C\c2ccc3c(c2)OCCO3)C(Cc2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C25H20N2O3/c28-25-21(15-19-11-12-23-24(17-19)30-14-13-29-23)22(16-18-7-3-1-4-8-18)26-27(25)20-9-5-2-6-10-20/h1-12,15,17H,13-14,16H2/b21-15- |
| InChIKey | RDXMBAGVNYILMI-QNGOZBTKSA-N |
| XLogP | 4.49 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|