C19H15NO4 — CID 108936607
(4E)-2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 108936607) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is (4E)-2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4E)-2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108936607 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (4E)-2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | O=C1OC(Cc2ccccc2)=N/C1=C/c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H15NO4/c21-19-15(20-18(24-19)12-13-4-2-1-3-5-13)10-14-6-7-16-17(11-14)23-9-8-22-16/h1-7,10-11H,8-9,12H2/b15-10+ |
| InChIKey | MESLEDRTHWQCQA-XNTDXEJSSA-N |
| XLogP | 3.00 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|