C17H13NO4S — CID 108936962
(4E)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylidene)-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 108936962) has the molecular formula C17H13NO4S and a molecular weight of 327.36 g/mol. Its IUPAC name is (4E)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylidene)-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4E)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylidene)-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108936962 |
| Molecular Formula | C17H13NO4S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | (4E)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylidene)-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccs2)=N/C1=C/c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C17H13NO4S/c19-17-12(18-16(22-17)15-3-1-8-23-15)9-11-4-5-13-14(10-11)21-7-2-6-20-13/h1,3-5,8-10H,2,6-7H2/b12-9+ |
| InChIKey | XXIWDPXUPSROOM-FMIVXFBMSA-N |
| XLogP | 3.25 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|