C13H7FN2O2S — CID 58533671
(4Z)-4-[(5-fluoro-3-pyridinyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 58533671) has the molecular formula C13H7FN2O2S and a molecular weight of 274.28 g/mol. Its IUPAC name is (4Z)-4-[(5-fluoro-3-pyridinyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(5-fluoro-3-pyridinyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 58533671 |
| Molecular Formula | C13H7FN2O2S |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | (4Z)-4-[(5-fluoro-3-pyridinyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccs2)=N/C1=C\c1cncc(F)c1 |
| InChI | InChI=1S/C13H7FN2O2S/c14-9-4-8(6-15-7-9)5-10-13(17)18-12(16-10)11-2-1-3-19-11/h1-7H/b10-5- |
| InChIKey | CQDWOSICFZQUPJ-YHYXMXQVSA-N |
| XLogP | 2.63 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|