C20H17NO6 — CID 108936606
(4E)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-(2,6-dimethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 108936606) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is (4E)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-(2,6-dimethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-(2,6-dimethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108936606 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (4E)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-(2,6-dimethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1cccc(OC)c1C1=N/C(=C/c2ccc3c(c2)OCCO3)C(=O)O1 |
| InChI | InChI=1S/C20H17NO6/c1-23-15-4-3-5-16(24-2)18(15)19-21-13(20(22)27-19)10-12-6-7-14-17(11-12)26-9-8-25-14/h3-7,10-11H,8-9H2,1-2H3/b13-10+ |
| InChIKey | JQWMFOSWVAPAEA-JLHYYAGUSA-N |
| XLogP | 2.82 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|