C26H20ClN3O3S2 — CID 135641861
(4E)-2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]pyrazol-3-one (PubChem CID 135641861) has the molecular formula C26H20ClN3O3S2 and a molecular weight of 522.05 g/mol. Its IUPAC name is (4E)-2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]pyrazol-3-one.
| Compound Name | (4E)-2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 135641861 |
| Molecular Formula | C26H20ClN3O3S2 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | (4E)-2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]pyrazol-3-one |
| SMILES | CCOc1cc(/C=C2/C(=O)N(c3nc4ccccc4s3)N=C2CSc2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C26H20ClN3O3S2/c1-2-33-23-14-16(7-12-22(23)31)13-19-21(15-34-18-10-8-17(27)9-11-18)29-30(25(19)32)26-28-20-5-3-4-6-24(20)35-26/h3-14,31H,2,15H2,1H3/b19-13+ |
| InChIKey | XDNXKQOUOYZIJA-CPNJWEJPSA-N |
| XLogP | 6.63 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|