C25H18ClN3O3S2 — CID 135641860
(4E)-2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrazol-3-one (PubChem CID 135641860) has the molecular formula C25H18ClN3O3S2 and a molecular weight of 508.02 g/mol. Its IUPAC name is (4E)-2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrazol-3-one.
| Compound Name | (4E)-2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 135641860 |
| Molecular Formula | C25H18ClN3O3S2 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | (4E)-2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrazol-3-one |
| SMILES | COc1cc(/C=C2/C(=O)N(c3nc4ccccc4s3)N=C2CSc2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C25H18ClN3O3S2/c1-32-22-13-15(6-11-21(22)30)12-18-20(14-33-17-9-7-16(26)8-10-17)28-29(24(18)31)25-27-19-4-2-3-5-23(19)34-25/h2-13,30H,14H2,1H3/b18-12+ |
| InChIKey | XGJZTBWYHSEEEA-LDADJPATSA-N |
| XLogP | 6.24 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|