C22H20N4O3S — CID 4637740
methyl 2-[1-(1,3-benzothiazol-2-yl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxopyrazol-3-yl]acetate (PubChem CID 4637740) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is methyl 2-[1-(1,3-benzothiazol-2-yl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxopyrazol-3-yl]acetate.
| Compound Name | methyl 2-[1-(1,3-benzothiazol-2-yl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxopyrazol-3-yl]acetate |
|---|---|
| PubChem CID | 4637740 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | methyl 2-[1-(1,3-benzothiazol-2-yl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxopyrazol-3-yl]acetate |
| SMILES | COC(=O)CC1=NN(c2nc3ccccc3s2)C(=O)C1=Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H20N4O3S/c1-25(2)15-10-8-14(9-11-15)12-16-18(13-20(27)29-3)24-26(21(16)28)22-23-17-6-4-5-7-19(17)30-22/h4-12H,13H2,1-3H3 |
| InChIKey | CDHIOASFIWLNKB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|