C23H27N5O2S — CID 121107917
N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-N'-[4-(dimethylamino)phenyl]oxamide (PubChem CID 121107917) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-N'-[4-(dimethylamino)phenyl]oxamide.
| Compound Name | N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-N'-[4-(dimethylamino)phenyl]oxamide |
|---|---|
| PubChem CID | 121107917 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-N'-[4-(dimethylamino)phenyl]oxamide |
| SMILES | CN(C)c1ccc(NC(=O)C(=O)NCC2CCN(c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C23H27N5O2S/c1-27(2)18-9-7-17(8-10-18)25-22(30)21(29)24-15-16-11-13-28(14-12-16)23-26-19-5-3-4-6-20(19)31-23/h3-10,16H,11-15H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | VFGABTQXGWTDIG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|