C22H25N3O3S — CID 121109264
N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-2,6-dimethoxybenzamide (PubChem CID 121109264) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 121109264 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCC1CCN(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C22H25N3O3S/c1-27-17-7-5-8-18(28-2)20(17)21(26)23-14-15-10-12-25(13-11-15)22-24-16-6-3-4-9-19(16)29-22/h3-9,15H,10-14H2,1-2H3,(H,23,26) |
| InChIKey | LMVYMZSISYIVDK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |