C18H24N4O2S — CID 121107882
N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-N'-propan-2-yloxamide (PubChem CID 121107882) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-N'-propan-2-yloxamide.
| Compound Name | N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 121107882 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NCC1CCN(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C18H24N4O2S/c1-12(2)20-17(24)16(23)19-11-13-7-9-22(10-8-13)18-21-14-5-3-4-6-15(14)25-18/h3-6,12-13H,7-11H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | PCFXOPLQJUSQNX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|