C24H15Cl2N3OS2 — CID 6512767
(4E)-2-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)methylidene]-5-[(4-chlorophenyl)sulfanylmethyl]pyrazol-3-one (PubChem CID 6512767) has the molecular formula C24H15Cl2N3OS2 and a molecular weight of 496.44 g/mol. Its IUPAC name is (4E)-2-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)methylidene]-5-[(4-chlorophenyl)sulfanylmethyl]pyrazol-3-one.
| Compound Name | (4E)-2-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)methylidene]-5-[(4-chlorophenyl)sulfanylmethyl]pyrazol-3-one |
|---|---|
| PubChem CID | 6512767 |
| Molecular Formula | C24H15Cl2N3OS2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | (4E)-2-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)methylidene]-5-[(4-chlorophenyl)sulfanylmethyl]pyrazol-3-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)cc2)C(CSc2ccc(Cl)cc2)=NN1c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H15Cl2N3OS2/c25-16-7-5-15(6-8-16)13-19-21(14-31-18-11-9-17(26)10-12-18)28-29(23(19)30)24-27-20-3-1-2-4-22(20)32-24/h1-13H,14H2/b19-13+ |
| InChIKey | WIEOVGWWLSBLMX-CPNJWEJPSA-N |
| XLogP | 7.18 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|