C26H21N3O3S2 — CID 6055134
(4Z)-2-(1,3-benzothiazol-2-yl)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one (PubChem CID 6055134) has the molecular formula C26H21N3O3S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is (4Z)-2-(1,3-benzothiazol-2-yl)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one.
| Compound Name | (4Z)-2-(1,3-benzothiazol-2-yl)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one |
|---|---|
| PubChem CID | 6055134 |
| Molecular Formula | C26H21N3O3S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | (4Z)-2-(1,3-benzothiazol-2-yl)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one |
| SMILES | COc1ccc(/C=C2\C(=O)N(c3nc4ccccc4s3)N=C2CSc2ccc(C)cc2)cc1O |
| InChI | InChI=1S/C26H21N3O3S2/c1-16-7-10-18(11-8-16)33-15-21-19(13-17-9-12-23(32-2)22(30)14-17)25(31)29(28-21)26-27-20-5-3-4-6-24(20)34-26/h3-14,30H,15H2,1-2H3/b19-13- |
| InChIKey | OSSVXNIFVBTEAV-UYRXBGFRSA-N |
| XLogP | 5.90 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|