C22H22N4O2S2 — CID 3437886
2-(1,3-benzothiazol-2-yl)-4-(2-methoxyethyliminomethyl)-5-[(4-methylphenyl)sulfanylmethyl]-1H-pyrazol-3-one (PubChem CID 3437886) has the molecular formula C22H22N4O2S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-(2-methoxyethyliminomethyl)-5-[(4-methylphenyl)sulfanylmethyl]-1H-pyrazol-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-(2-methoxyethyliminomethyl)-5-[(4-methylphenyl)sulfanylmethyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3437886 |
| Molecular Formula | C22H22N4O2S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-(2-methoxyethyliminomethyl)-5-[(4-methylphenyl)sulfanylmethyl]-1H-pyrazol-3-one |
| SMILES | COCC/N=C/c1c(CSc2ccc(C)cc2)[nH]n(-c2nc3ccccc3s2)c1=O |
| InChI | InChI=1S/C22H22N4O2S2/c1-15-7-9-16(10-8-15)29-14-19-17(13-23-11-12-28-2)21(27)26(25-19)22-24-18-5-3-4-6-20(18)30-22/h3-10,13,25H,11-12,14H2,1-2H3/b23-13+ |
| InChIKey | KXLBNJNCRJIDRN-YDZHTSKRSA-N |
| XLogP | 4.44 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|