C27H23N3O3S2 — CID 6520258
(4E)-2-(1,3-benzothiazol-2-yl)-4-[(3,4-dimethoxyphenyl)methylidene]-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one (PubChem CID 6520258) has the molecular formula C27H23N3O3S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is (4E)-2-(1,3-benzothiazol-2-yl)-4-[(3,4-dimethoxyphenyl)methylidene]-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one.
| Compound Name | (4E)-2-(1,3-benzothiazol-2-yl)-4-[(3,4-dimethoxyphenyl)methylidene]-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one |
|---|---|
| PubChem CID | 6520258 |
| Molecular Formula | C27H23N3O3S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | (4E)-2-(1,3-benzothiazol-2-yl)-4-[(3,4-dimethoxyphenyl)methylidene]-5-[(4-methylphenyl)sulfanylmethyl]pyrazol-3-one |
| SMILES | COc1ccc(/C=C2/C(=O)N(c3nc4ccccc4s3)N=C2CSc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C27H23N3O3S2/c1-17-8-11-19(12-9-17)34-16-22-20(14-18-10-13-23(32-2)24(15-18)33-3)26(31)30(29-22)27-28-21-6-4-5-7-25(21)35-27/h4-15H,16H2,1-3H3/b20-14+ |
| InChIKey | HAUKHHGLUBTHDF-XSFVSMFZSA-N |
| XLogP | 6.20 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|