C26H20ClN3O3S2 — CID 4584400
2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(3,4-dimethoxyphenyl)methylidene]pyrazol-3-one (PubChem CID 4584400) has the molecular formula C26H20ClN3O3S2 and a molecular weight of 522.05 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(3,4-dimethoxyphenyl)methylidene]pyrazol-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(3,4-dimethoxyphenyl)methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 4584400 |
| Molecular Formula | C26H20ClN3O3S2 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[(3,4-dimethoxyphenyl)methylidene]pyrazol-3-one |
| SMILES | COc1ccc(C=C2C(=O)N(c3nc4ccccc4s3)N=C2CSc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C26H20ClN3O3S2/c1-32-22-12-7-16(14-23(22)33-2)13-19-21(15-34-18-10-8-17(27)9-11-18)29-30(25(19)31)26-28-20-5-3-4-6-24(20)35-26/h3-14H,15H2,1-2H3 |
| InChIKey | ZHNDOZHLAXWEQO-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|