C29H26ClN5OS2 — CID 4099025
2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[1-(4-phenylpiperazin-1-yl)ethylidene]pyrazol-3-one (PubChem CID 4099025) has the molecular formula C29H26ClN5OS2 and a molecular weight of 560.15 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[1-(4-phenylpiperazin-1-yl)ethylidene]pyrazol-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[1-(4-phenylpiperazin-1-yl)ethylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 4099025 |
| Molecular Formula | C29H26ClN5OS2 |
| Molecular Weight | 560.15 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[1-(4-phenylpiperazin-1-yl)ethylidene]pyrazol-3-one |
| SMILES | CC(=C1C(=O)N(c2nc3ccccc3s2)N=C1CSc1ccc(Cl)cc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H26ClN5OS2/c1-20(33-15-17-34(18-16-33)22-7-3-2-4-8-22)27-25(19-37-23-13-11-21(30)12-14-23)32-35(28(27)36)29-31-24-9-5-6-10-26(24)38-29/h2-14H,15-19H2,1H3 |
| InChIKey | OIOFWZFQBJCCPQ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 52.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.15 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|