C23H19F4N5OS — CID 1417055
(4E)-2-(1,3-benzothiazol-2-yl)-4-[1-[4-(4-fluorophenyl)piperazin-1-yl]ethylidene]-5-(trifluoromethyl)pyrazol-3-one (PubChem CID 1417055) has the molecular formula C23H19F4N5OS and a molecular weight of 489.50 g/mol. Its IUPAC name is (4E)-2-(1,3-benzothiazol-2-yl)-4-[1-[4-(4-fluorophenyl)piperazin-1-yl]ethylidene]-5-(trifluoromethyl)pyrazol-3-one.
| Compound Name | (4E)-2-(1,3-benzothiazol-2-yl)-4-[1-[4-(4-fluorophenyl)piperazin-1-yl]ethylidene]-5-(trifluoromethyl)pyrazol-3-one |
|---|---|
| PubChem CID | 1417055 |
| Molecular Formula | C23H19F4N5OS |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | (4E)-2-(1,3-benzothiazol-2-yl)-4-[1-[4-(4-fluorophenyl)piperazin-1-yl]ethylidene]-5-(trifluoromethyl)pyrazol-3-one |
| SMILES | C/C(=C1\C(=O)N(c2nc3ccccc3s2)N=C1C(F)(F)F)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H19F4N5OS/c1-14(30-10-12-31(13-11-30)16-8-6-15(24)7-9-16)19-20(23(25,26)27)29-32(21(19)33)22-28-17-4-2-3-5-18(17)34-22/h2-9H,10-13H2,1H3/b19-14+ |
| InChIKey | YFZWHSNTFWODBY-XMHGGMMESA-N |
| XLogP | 4.80 |
| TPSA | 52.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|