C15H10F3N3O3S2 — CID 1224780
2-[(1Z)-1-[1-(1,3-benzothiazol-2-yl)-5-oxo-3-(trifluoromethyl)pyrazol-4-ylidene]ethyl]sulfanylacetic acid (PubChem CID 1224780) has the molecular formula C15H10F3N3O3S2 and a molecular weight of 401.39 g/mol. Its IUPAC name is 2-[(1Z)-1-[1-(1,3-benzothiazol-2-yl)-5-oxo-3-(trifluoromethyl)pyrazol-4-ylidene]ethyl]sulfanylacetic acid.
| Compound Name | 2-[(1Z)-1-[1-(1,3-benzothiazol-2-yl)-5-oxo-3-(trifluoromethyl)pyrazol-4-ylidene]ethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 1224780 |
| Molecular Formula | C15H10F3N3O3S2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 2-[(1Z)-1-[1-(1,3-benzothiazol-2-yl)-5-oxo-3-(trifluoromethyl)pyrazol-4-ylidene]ethyl]sulfanylacetic acid |
| SMILES | C/C(SCC(=O)O)=C1/C(=O)N(c2nc3ccccc3s2)N=C1C(F)(F)F |
| InChI | InChI=1S/C15H10F3N3O3S2/c1-7(25-6-10(22)23)11-12(15(16,17)18)20-21(13(11)24)14-19-8-4-2-3-5-9(8)26-14/h2-5H,6H2,1H3,(H,22,23)/b11-7- |
| InChIKey | LGPBGRKBHQMCHG-XFFZJAGNSA-N |
| XLogP | 3.65 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|