C16H12F3N4O3S- — CID 7317519
3-[1-[1-(1,3-benzothiazol-2-yl)-5-oxo-3-(trifluoromethyl)-4H-pyrazol-4-yl]ethylideneamino]propanoate (PubChem CID 7317519) has the molecular formula C16H12F3N4O3S- and a molecular weight of 397.36 g/mol. Its IUPAC name is 3-[1-[1-(1,3-benzothiazol-2-yl)-5-oxo-3-(trifluoromethyl)-4H-pyrazol-4-yl]ethylideneamino]propanoate.
| Compound Name | 3-[1-[1-(1,3-benzothiazol-2-yl)-5-oxo-3-(trifluoromethyl)-4H-pyrazol-4-yl]ethylideneamino]propanoate |
|---|---|
| PubChem CID | 7317519 |
| Molecular Formula | C16H12F3N4O3S- |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 3-[1-[1-(1,3-benzothiazol-2-yl)-5-oxo-3-(trifluoromethyl)-4H-pyrazol-4-yl]ethylideneamino]propanoate |
| SMILES | C/C(=N\CCC(=O)[O-])C1C(=O)N(c2nc3ccccc3s2)N=C1C(F)(F)F |
| InChI | InChI=1S/C16H13F3N4O3S/c1-8(20-7-6-11(24)25)12-13(16(17,18)19)22-23(14(12)26)15-21-9-4-2-3-5-10(9)27-15/h2-5,12H,6-7H2,1H3,(H,24,25)/p-1/b20-8+ |
| InChIKey | XFAUXLDMSRIPPO-DNTJNYDQSA-M |
| XLogP | 1.78 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|