C17H15F3N4OS — CID 1270697
(4S)-2-(1,3-benzothiazol-2-yl)-4-(cyclopentyliminomethyl)-5-(trifluoromethyl)-4H-pyrazol-3-one (PubChem CID 1270697) has the molecular formula C17H15F3N4OS and a molecular weight of 380.40 g/mol. Its IUPAC name is (4S)-2-(1,3-benzothiazol-2-yl)-4-(cyclopentyliminomethyl)-5-(trifluoromethyl)-4H-pyrazol-3-one.
| Compound Name | (4S)-2-(1,3-benzothiazol-2-yl)-4-(cyclopentyliminomethyl)-5-(trifluoromethyl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 1270697 |
| Molecular Formula | C17H15F3N4OS |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (4S)-2-(1,3-benzothiazol-2-yl)-4-(cyclopentyliminomethyl)-5-(trifluoromethyl)-4H-pyrazol-3-one |
| SMILES | O=C1[C@@H](/C=N/C2CCCC2)C(C(F)(F)F)=NN1c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H15F3N4OS/c18-17(19,20)14-11(9-21-10-5-1-2-6-10)15(25)24(23-14)16-22-12-7-3-4-8-13(12)26-16/h3-4,7-11H,1-2,5-6H2/b21-9+/t11-/m0/s1 |
| InChIKey | YLQWJKDVZDOEBK-PQDFQZGZSA-N |
| XLogP | 4.19 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|