1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid

C12H12N2O2S — CID 16783768

IUPAC1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid
SMILESO=C(O)C1CCCN1c1nc2ccccc2s1
InChIInChI=1S/C12H12N2O2S/c15-11(16)9-5-3-7-14(9)12-13-8-4-1-2-6-10(8)17-12/h1-2,4,6,9H,3,5,7H2,(H,15,16)
InChIKeyWIVBNGYRUYSJKJ-UHFFFAOYSA-N
MW248.31 g/mol
LogP2.35
Rot. Bonds2

About 1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid

1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid (PubChem CID 16783768) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid
PubChem CID16783768
Molecular FormulaC12H12N2O2S
Molecular Weight248.31 g/mol
Exact Mass248.06
IUPAC Name1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid
SMILESO=C(O)C1CCCN1c1nc2ccccc2s1
InChIInChI=1S/C12H12N2O2S/c15-11(16)9-5-3-7-14(9)12-13-8-4-1-2-6-10(8)17-12/h1-2,4,6,9H,3,5,7H2,(H,15,16)
InChIKeyWIVBNGYRUYSJKJ-UHFFFAOYSA-N
XLogP2.35
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.31
LogP ≤ 52.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid?
The IUPAC name of 1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid (CID 16783768) is 1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for 1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid is O=C(O)C1CCCN1c1nc2ccccc2s1.
What is the InChIKey of 1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid?
The InChIKey is WIVBNGYRUYSJKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c15-11(16)9-5-3-7-14(9)12-13-8-4-1-2-6-10(8)17-12/h1-2,4,6,9H,3,5,7H2,(H,15,16).
What are the key properties of 1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid?
1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid has a molecular weight of 248.31 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzothiazol-2-yl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 16783768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).