1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid

C15H18N2O2S — CID 56724806

IUPAC1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid
SMILESCCc1cccc2sc(N3CCCCC3C(=O)O)nc12
InChIInChI=1S/C15H18N2O2S/c1-2-10-6-5-8-12-13(10)16-15(20-12)17-9-4-3-7-11(17)14(18)19/h5-6,8,11H,2-4,7,9H2,1H3,(H,18,19)
InChIKeyKDQADZMGBANALH-UHFFFAOYSA-N
MW290.39 g/mol
LogP3.30
Rot. Bonds3

About 1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid

1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid (PubChem CID 56724806) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid.

Molecular Properties

Compound Name1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid
PubChem CID56724806
Molecular FormulaC15H18N2O2S
Molecular Weight290.39 g/mol
Exact Mass290.11
IUPAC Name1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid
SMILESCCc1cccc2sc(N3CCCCC3C(=O)O)nc12
InChIInChI=1S/C15H18N2O2S/c1-2-10-6-5-8-12-13(10)16-15(20-12)17-9-4-3-7-11(17)14(18)19/h5-6,8,11H,2-4,7,9H2,1H3,(H,18,19)
InChIKeyKDQADZMGBANALH-UHFFFAOYSA-N
XLogP3.30
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.39
LogP ≤ 53.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid?
The IUPAC name of 1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid (CID 56724806) is 1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid.
What is the SMILES notation for 1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid?
The canonical SMILES for 1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid is CCc1cccc2sc(N3CCCCC3C(=O)O)nc12.
What is the InChIKey of 1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid?
The InChIKey is KDQADZMGBANALH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S/c1-2-10-6-5-8-12-13(10)16-15(20-12)17-9-4-3-7-11(17)14(18)19/h5-6,8,11H,2-4,7,9H2,1H3,(H,18,19).
What are the key properties of 1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid?
1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid has a molecular weight of 290.39 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid is sourced from PubChem (CID 56724806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).