C14H16N2O3S — CID 56724809
1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid (PubChem CID 56724809) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid.
| Compound Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 56724809 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-2-carboxylic acid |
| SMILES | COc1ccc2nc(N3CCCCC3C(=O)O)sc2c1 |
| InChI | InChI=1S/C14H16N2O3S/c1-19-9-5-6-10-12(8-9)20-14(15-10)16-7-3-2-4-11(16)13(17)18/h5-6,8,11H,2-4,7H2,1H3,(H,17,18) |
| InChIKey | WHFKCHRYDJFFSZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |