C23H19F3N6O3S — CID 6175443
(4Z)-2-(1,3-benzothiazol-2-yl)-4-[1-[4-(4-nitrophenyl)piperazin-1-yl]ethylidene]-5-(trifluoromethyl)pyrazol-3-one (PubChem CID 6175443) has the molecular formula C23H19F3N6O3S and a molecular weight of 516.51 g/mol. Its IUPAC name is (4Z)-2-(1,3-benzothiazol-2-yl)-4-[1-[4-(4-nitrophenyl)piperazin-1-yl]ethylidene]-5-(trifluoromethyl)pyrazol-3-one.
| Compound Name | (4Z)-2-(1,3-benzothiazol-2-yl)-4-[1-[4-(4-nitrophenyl)piperazin-1-yl]ethylidene]-5-(trifluoromethyl)pyrazol-3-one |
|---|---|
| PubChem CID | 6175443 |
| Molecular Formula | C23H19F3N6O3S |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | (4Z)-2-(1,3-benzothiazol-2-yl)-4-[1-[4-(4-nitrophenyl)piperazin-1-yl]ethylidene]-5-(trifluoromethyl)pyrazol-3-one |
| SMILES | C/C(=C1/C(=O)N(c2nc3ccccc3s2)N=C1C(F)(F)F)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C23H19F3N6O3S/c1-14(29-10-12-30(13-11-29)15-6-8-16(9-7-15)32(34)35)19-20(23(24,25)26)28-31(21(19)33)22-27-17-4-2-3-5-18(17)36-22/h2-9H,10-13H2,1H3/b19-14- |
| InChIKey | WYCFEWFCBGCYAD-RGEXLXHISA-N |
| XLogP | 4.57 |
| TPSA | 95.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|