C26H21ClN4OS2 — CID 2874875
2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[[4-(dimethylamino)phenyl]methylidene]pyrazol-3-one (PubChem CID 2874875) has the molecular formula C26H21ClN4OS2 and a molecular weight of 505.07 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[[4-(dimethylamino)phenyl]methylidene]pyrazol-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[[4-(dimethylamino)phenyl]methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 2874875 |
| Molecular Formula | C26H21ClN4OS2 |
| Molecular Weight | 505.07 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-[(4-chlorophenyl)sulfanylmethyl]-4-[[4-(dimethylamino)phenyl]methylidene]pyrazol-3-one |
| SMILES | CN(C)c1ccc(C=C2C(=O)N(c3nc4ccccc4s3)N=C2CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H21ClN4OS2/c1-30(2)19-11-7-17(8-12-19)15-21-23(16-33-20-13-9-18(27)10-14-20)29-31(25(21)32)26-28-22-5-3-4-6-24(22)34-26/h3-15H,16H2,1-2H3 |
| InChIKey | WYYPOXKTIJFXQW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.07 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|