C25H21ClN2O2S — CID 4011107
5-[(4-chlorophenyl)sulfanylmethyl]-4-[(4-ethoxyphenyl)methylidene]-2-phenylpyrazol-3-one (PubChem CID 4011107) has the molecular formula C25H21ClN2O2S and a molecular weight of 448.98 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)sulfanylmethyl]-4-[(4-ethoxyphenyl)methylidene]-2-phenylpyrazol-3-one.
| Compound Name | 5-[(4-chlorophenyl)sulfanylmethyl]-4-[(4-ethoxyphenyl)methylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 4011107 |
| Molecular Formula | C25H21ClN2O2S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 5-[(4-chlorophenyl)sulfanylmethyl]-4-[(4-ethoxyphenyl)methylidene]-2-phenylpyrazol-3-one |
| SMILES | CCOc1ccc(C=C2C(=O)N(c3ccccc3)N=C2CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H21ClN2O2S/c1-2-30-21-12-8-18(9-13-21)16-23-24(17-31-22-14-10-19(26)11-15-22)27-28(25(23)29)20-6-4-3-5-7-20/h3-16H,2,17H2,1H3 |
| InChIKey | QBEJJAKCZVFPKS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|