C36H32N4O2S — CID 6390415
(4E)-5-[(4-methylphenyl)sulfanylmethyl]-2-phenyl-4-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]pyrazol-3-one (PubChem CID 6390415) has the molecular formula C36H32N4O2S and a molecular weight of 584.75 g/mol. Its IUPAC name is (4E)-5-[(4-methylphenyl)sulfanylmethyl]-2-phenyl-4-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]pyrazol-3-one.
| Compound Name | (4E)-5-[(4-methylphenyl)sulfanylmethyl]-2-phenyl-4-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 6390415 |
| Molecular Formula | C36H32N4O2S |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | (4E)-5-[(4-methylphenyl)sulfanylmethyl]-2-phenyl-4-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]pyrazol-3-one |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(c3ccccc3)N=C2CSc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C36H32N4O2S/c1-3-22-42-31-18-16-27(17-19-31)35-28(24-39(38-35)29-10-6-4-7-11-29)23-33-34(25-43-32-20-14-26(2)15-21-32)37-40(36(33)41)30-12-8-5-9-13-30/h4-21,23-24H,3,22,25H2,1-2H3/b33-23+ |
| InChIKey | FRUXUSJQBIGBFF-GZZLJNBRSA-N |
| XLogP | 8.22 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|