C30H22N4O2S — CID 118670595
(4E)-4-[[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-phenyl-5-(phenylsulfanylmethyl)pyrazol-3-one (PubChem CID 118670595) has the molecular formula C30H22N4O2S and a molecular weight of 502.60 g/mol. Its IUPAC name is (4E)-4-[[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-phenyl-5-(phenylsulfanylmethyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-phenyl-5-(phenylsulfanylmethyl)pyrazol-3-one |
|---|---|
| PubChem CID | 118670595 |
| Molecular Formula | C30H22N4O2S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | (4E)-4-[[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-phenyl-5-(phenylsulfanylmethyl)pyrazol-3-one |
| SMILES | O=C1/C(=C/c2cn(-c3ccccc3)nc2-c2ccco2)C(CSc2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C30H22N4O2S/c35-30-26(19-22-20-33(23-11-4-1-5-12-23)32-29(22)28-17-10-18-36-28)27(21-37-25-15-8-3-9-16-25)31-34(30)24-13-6-2-7-14-24/h1-20H,21H2/b26-19+ |
| InChIKey | DIHAQXXRWZPWDD-LGUFXXKBSA-N |
| XLogP | 6.71 |
| TPSA | 63.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|