C40H31FN4O2S — CID 4700117
4-[[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one (PubChem CID 4700117) has the molecular formula C40H31FN4O2S and a molecular weight of 650.78 g/mol. Its IUPAC name is 4-[[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 4700117 |
| Molecular Formula | C40H31FN4O2S |
| Molecular Weight | 650.78 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | 4-[[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
| SMILES | Cc1ccc(SCC2=NN(c3ccccc3)C(=O)C2=Cc2cn(-c3ccccc3)nc2-c2cccc(OCc3ccccc3F)c2)cc1 |
| InChI | InChI=1S/C40H31FN4O2S/c1-28-19-21-35(22-20-28)48-27-38-36(40(46)45(42-38)33-15-6-3-7-16-33)24-31-25-44(32-13-4-2-5-14-32)43-39(31)29-12-10-17-34(23-29)47-26-30-11-8-9-18-37(30)41/h2-25H,26-27H2,1H3 |
| InChIKey | LYEZCEIKHNVSHJ-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.78 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|