C41H34N4O2S — CID 3291885
4-[[3-[4-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one (PubChem CID 3291885) has the molecular formula C41H34N4O2S and a molecular weight of 646.82 g/mol. Its IUPAC name is 4-[[3-[4-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-[4-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 3291885 |
| Molecular Formula | C41H34N4O2S |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 4-[[3-[4-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
| SMILES | Cc1ccc(COc2ccc(-c3nn(-c4ccccc4)cc3C=C3C(=O)N(c4ccccc4)N=C3CSc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H34N4O2S/c1-29-13-17-31(18-14-29)27-47-36-21-19-32(20-22-36)40-33(26-44(43-40)34-9-5-3-6-10-34)25-38-39(28-48-37-23-15-30(2)16-24-37)42-45(41(38)46)35-11-7-4-8-12-35/h3-26H,27-28H2,1-2H3 |
| InChIKey | BSINQMAKHOXKFE-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|