C21H14ClN3O3S — CID 6614916
4-(1,3-benzodioxol-5-ylmethylidene)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-one (PubChem CID 6614916) has the molecular formula C21H14ClN3O3S and a molecular weight of 423.88 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylidene)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-one.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethylidene)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 6614916 |
| Molecular Formula | C21H14ClN3O3S |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethylidene)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-one |
| SMILES | CC1=NN(c2nc(-c3ccc(Cl)cc3)cs2)C(=O)C1=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H14ClN3O3S/c1-12-16(8-13-2-7-18-19(9-13)28-11-27-18)20(26)25(24-12)21-23-17(10-29-21)14-3-5-15(22)6-4-14/h2-10H,11H2,1H3 |
| InChIKey | BQZBHAKUZMYCEO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|