C17H10ClFN2O4 — CID 1371913
(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(3-chloro-4-fluorophenyl)pyrazolidine-3,5-dione (PubChem CID 1371913) has the molecular formula C17H10ClFN2O4 and a molecular weight of 360.73 g/mol. Its IUPAC name is (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(3-chloro-4-fluorophenyl)pyrazolidine-3,5-dione.
| Compound Name | (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(3-chloro-4-fluorophenyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 1371913 |
| Molecular Formula | C17H10ClFN2O4 |
| Molecular Weight | 360.73 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(3-chloro-4-fluorophenyl)pyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccc(F)c(Cl)c2)C(=O)/C1=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H10ClFN2O4/c18-12-7-10(2-3-13(12)19)21-17(23)11(16(22)20-21)5-9-1-4-14-15(6-9)25-8-24-14/h1-7H,8H2,(H,20,22)/b11-5+ |
| InChIKey | DANYWFZKJMPHKM-VZUCSPMQSA-N |
| XLogP | 2.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.73 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|