C19H14ClFN2O3 — CID 127243582
(4E)-1-(3-chloro-4-fluorophenyl)-4-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrazolidine-3,5-dione (PubChem CID 127243582) has the molecular formula C19H14ClFN2O3 and a molecular weight of 372.78 g/mol. Its IUPAC name is (4E)-1-(3-chloro-4-fluorophenyl)-4-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | (4E)-1-(3-chloro-4-fluorophenyl)-4-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 127243582 |
| Molecular Formula | C19H14ClFN2O3 |
| Molecular Weight | 372.78 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (4E)-1-(3-chloro-4-fluorophenyl)-4-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrazolidine-3,5-dione |
| SMILES | CC1Cc2cc(/C=C3\C(=O)NN(c4ccc(F)c(Cl)c4)C3=O)ccc2O1 |
| InChI | InChI=1S/C19H14ClFN2O3/c1-10-6-12-7-11(2-5-17(12)26-10)8-14-18(24)22-23(19(14)25)13-3-4-16(21)15(20)9-13/h2-5,7-10H,6H2,1H3,(H,22,24)/b14-8+ |
| InChIKey | LOHFBMADEYULMM-RIYZIHGNSA-N |
| XLogP | 3.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.78 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|