C20H19ClFN3O3 — CID 4254765
1-(3-chloro-4-fluorophenyl)-4-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]pyrazolidine-3,5-dione (PubChem CID 4254765) has the molecular formula C20H19ClFN3O3 and a molecular weight of 403.84 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-4-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]pyrazolidine-3,5-dione.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-4-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 4254765 |
| Molecular Formula | C20H19ClFN3O3 |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-4-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]pyrazolidine-3,5-dione |
| SMILES | CCN(CC)c1ccc(C=C2C(=O)NN(c3ccc(F)c(Cl)c3)C2=O)c(O)c1 |
| InChI | InChI=1S/C20H19ClFN3O3/c1-3-24(4-2)13-6-5-12(18(26)11-13)9-15-19(27)23-25(20(15)28)14-7-8-17(22)16(21)10-14/h5-11,26H,3-4H2,1-2H3,(H,23,27) |
| InChIKey | IKRVVZFMUCSRBH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|