C17H11BrN2O4 — CID 1075243
4-(1,3-benzodioxol-5-ylmethylidene)-1-(3-bromophenyl)pyrazolidine-3,5-dione (PubChem CID 1075243) has the molecular formula C17H11BrN2O4 and a molecular weight of 387.19 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylidene)-1-(3-bromophenyl)pyrazolidine-3,5-dione.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethylidene)-1-(3-bromophenyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 1075243 |
| Molecular Formula | C17H11BrN2O4 |
| Molecular Weight | 387.19 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethylidene)-1-(3-bromophenyl)pyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2cccc(Br)c2)C(=O)C1=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H11BrN2O4/c18-11-2-1-3-12(8-11)20-17(22)13(16(21)19-20)6-10-4-5-14-15(7-10)24-9-23-14/h1-8H,9H2,(H,19,21) |
| InChIKey | DIOSDBWAGXSSJI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|