C15H12N4OS2 — CID 102428147
4,5-dimethyl-10-phenyl-11-sulfanylidene-6-thia-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 102428147) has the molecular formula C15H12N4OS2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4,5-dimethyl-10-phenyl-11-sulfanylidene-6-thia-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 4,5-dimethyl-10-phenyl-11-sulfanylidene-6-thia-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 102428147 |
| Molecular Formula | C15H12N4OS2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 4,5-dimethyl-10-phenyl-11-sulfanylidene-6-thia-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | Cc1sc2nc3n(-c4ccccc4)c(=S)[nH]n3c(=O)c2c1C |
| InChI | InChI=1S/C15H12N4OS2/c1-8-9(2)22-12-11(8)13(20)19-14(16-12)18(15(21)17-19)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,17,21) |
| InChIKey | LPRZGSZJTPYSQV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|