C15H11N5S — CID 1480229
3,7-diphenyl-5H-[1,2,4]triazolo[4,3-b][1,2,4]triazole-6-thione (PubChem CID 1480229) has the molecular formula C15H11N5S and a molecular weight of 293.36 g/mol. Its IUPAC name is 3,7-diphenyl-5H-[1,2,4]triazolo[4,3-b][1,2,4]triazole-6-thione.
| Compound Name | 3,7-diphenyl-5H-[1,2,4]triazolo[4,3-b][1,2,4]triazole-6-thione |
|---|---|
| PubChem CID | 1480229 |
| Molecular Formula | C15H11N5S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3,7-diphenyl-5H-[1,2,4]triazolo[4,3-b][1,2,4]triazole-6-thione |
| SMILES | S=c1[nH]n2c(-c3ccccc3)nnc2n1-c1ccccc1 |
| InChI | InChI=1S/C15H11N5S/c21-15-18-20-13(11-7-3-1-4-8-11)16-17-14(20)19(15)12-9-5-2-6-10-12/h1-10H,(H,18,21) |
| InChIKey | LILOKGFAYWLFMW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|