C15H8N6OS2 — CID 24796220
14-phenyl-13-sulfanylidene-8-thia-3,6,11,12,14,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,15-pentaen-10-one (PubChem CID 24796220) has the molecular formula C15H8N6OS2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 14-phenyl-13-sulfanylidene-8-thia-3,6,11,12,14,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,15-pentaen-10-one.
| Compound Name | 14-phenyl-13-sulfanylidene-8-thia-3,6,11,12,14,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,15-pentaen-10-one |
|---|---|
| PubChem CID | 24796220 |
| Molecular Formula | C15H8N6OS2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 14-phenyl-13-sulfanylidene-8-thia-3,6,11,12,14,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,15-pentaen-10-one |
| SMILES | O=c1c2sc3nccnc3c2nc2n(-c3ccccc3)c(=S)[nH]n12 |
| InChI | InChI=1S/C15H8N6OS2/c22-13-11-9(10-12(24-11)17-7-6-16-10)18-14-20(15(23)19-21(13)14)8-4-2-1-3-5-8/h1-7H,(H,19,23) |
| InChIKey | YSAJTSWJFZYJIU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|