C9H9N3OS — CID 91733938
1-methyl-4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 91733938) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is 1-methyl-4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 1-methyl-4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 91733938 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 1-methyl-4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | Cn1[nH]c(=O)n(-c2ccccc2)c1=S |
| InChI | InChI=1S/C9H9N3OS/c1-11-9(14)12(8(13)10-11)7-5-3-2-4-6-7/h2-6H,1H3,(H,10,13) |
| InChIKey | NGWAJHJNTISDNC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 42.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|