C9H6N2OS3 — CID 14201302
3-phenyl-4,6-bis(sulfanylidene)-1,3,5-thiadiazinan-2-one (PubChem CID 14201302) has the molecular formula C9H6N2OS3 and a molecular weight of 254.36 g/mol. Its IUPAC name is 3-phenyl-4,6-bis(sulfanylidene)-1,3,5-thiadiazinan-2-one.
| Compound Name | 3-phenyl-4,6-bis(sulfanylidene)-1,3,5-thiadiazinan-2-one |
|---|---|
| PubChem CID | 14201302 |
| Molecular Formula | C9H6N2OS3 |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 3-phenyl-4,6-bis(sulfanylidene)-1,3,5-thiadiazinan-2-one |
| SMILES | O=c1sc(=S)[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C9H6N2OS3/c12-9-11(6-4-2-1-3-5-6)7(13)10-8(14)15-9/h1-5H,(H,10,13,14) |
| InChIKey | GBOLQYMXVNYLOV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|