C25H21N3O2S — CID 11532006
3,4,8-trimethyl-12-(2-methylphenoxy)-11-phenyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one (PubChem CID 11532006) has the molecular formula C25H21N3O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is 3,4,8-trimethyl-12-(2-methylphenoxy)-11-phenyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one.
| Compound Name | 3,4,8-trimethyl-12-(2-methylphenoxy)-11-phenyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
|---|---|
| PubChem CID | 11532006 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 3,4,8-trimethyl-12-(2-methylphenoxy)-11-phenyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
| SMILES | Cc1ccccc1Oc1nc2c(c(C)nc3sc(C)c(C)c32)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C25H21N3O2S/c1-14-10-8-9-13-19(14)30-25-27-22-20-15(2)17(4)31-23(20)26-16(3)21(22)24(29)28(25)18-11-6-5-7-12-18/h5-13H,1-4H3 |
| InChIKey | MHHHHOKGJBDVQH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |