C24H16Cl2FN3O2S — CID 102318917
12-(2-chloro-4-fluorophenoxy)-11-(4-chlorophenyl)-3,4,8-trimethyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one (PubChem CID 102318917) has the molecular formula C24H16Cl2FN3O2S and a molecular weight of 500.38 g/mol. Its IUPAC name is 12-(2-chloro-4-fluorophenoxy)-11-(4-chlorophenyl)-3,4,8-trimethyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one.
| Compound Name | 12-(2-chloro-4-fluorophenoxy)-11-(4-chlorophenyl)-3,4,8-trimethyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
|---|---|
| PubChem CID | 102318917 |
| Molecular Formula | C24H16Cl2FN3O2S |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | 12-(2-chloro-4-fluorophenoxy)-11-(4-chlorophenyl)-3,4,8-trimethyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
| SMILES | Cc1sc2nc(C)c3c(=O)n(-c4ccc(Cl)cc4)c(Oc4ccc(F)cc4Cl)nc3c2c1C |
| InChI | InChI=1S/C24H16Cl2FN3O2S/c1-11-13(3)33-22-19(11)21-20(12(2)28-22)23(31)30(16-7-4-14(25)5-8-16)24(29-21)32-18-9-6-15(27)10-17(18)26/h4-10H,1-3H3 |
| InChIKey | DIKYYJALVMXTNC-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |