C24H27ClN4OS — CID 102318916
11-(4-chlorophenyl)-12-(dipropylamino)-3,4,8-trimethyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one (PubChem CID 102318916) has the molecular formula C24H27ClN4OS and a molecular weight of 455.03 g/mol. Its IUPAC name is 11-(4-chlorophenyl)-12-(dipropylamino)-3,4,8-trimethyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one.
| Compound Name | 11-(4-chlorophenyl)-12-(dipropylamino)-3,4,8-trimethyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
|---|---|
| PubChem CID | 102318916 |
| Molecular Formula | C24H27ClN4OS |
| Molecular Weight | 455.03 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 11-(4-chlorophenyl)-12-(dipropylamino)-3,4,8-trimethyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
| SMILES | CCCN(CCC)c1nc2c(c(C)nc3sc(C)c(C)c32)c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H27ClN4OS/c1-6-12-28(13-7-2)24-27-21-19-14(3)16(5)31-22(19)26-15(4)20(21)23(30)29(24)18-10-8-17(25)9-11-18/h8-11H,6-7,12-13H2,1-5H3 |
| InChIKey | WKDJMXKWBRJYPE-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.03 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |