C25H30ClN3O — CID 102458541
5-benzyl-3-(4-chlorophenyl)-2-(dibutylamino)pyrimidin-4-one (PubChem CID 102458541) has the molecular formula C25H30ClN3O and a molecular weight of 423.99 g/mol. Its IUPAC name is 5-benzyl-3-(4-chlorophenyl)-2-(dibutylamino)pyrimidin-4-one.
| Compound Name | 5-benzyl-3-(4-chlorophenyl)-2-(dibutylamino)pyrimidin-4-one |
|---|---|
| PubChem CID | 102458541 |
| Molecular Formula | C25H30ClN3O |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 5-benzyl-3-(4-chlorophenyl)-2-(dibutylamino)pyrimidin-4-one |
| SMILES | CCCCN(CCCC)c1ncc(Cc2ccccc2)c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H30ClN3O/c1-3-5-16-28(17-6-4-2)25-27-19-21(18-20-10-8-7-9-11-20)24(30)29(25)23-14-12-22(26)13-15-23/h7-15,19H,3-6,16-18H2,1-2H3 |
| InChIKey | ANLFFEBPKQPRFB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |