C25H20ClN3O2S — CID 11691176
12-(2-chloro-5-methylphenoxy)-3,4,8-trimethyl-11-phenyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one (PubChem CID 11691176) has the molecular formula C25H20ClN3O2S and a molecular weight of 461.97 g/mol. Its IUPAC name is 12-(2-chloro-5-methylphenoxy)-3,4,8-trimethyl-11-phenyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one.
| Compound Name | 12-(2-chloro-5-methylphenoxy)-3,4,8-trimethyl-11-phenyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
|---|---|
| PubChem CID | 11691176 |
| Molecular Formula | C25H20ClN3O2S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 12-(2-chloro-5-methylphenoxy)-3,4,8-trimethyl-11-phenyl-5-thia-7,11,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
| SMILES | Cc1ccc(Cl)c(Oc2nc3c(c(C)nc4sc(C)c(C)c43)c(=O)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C25H20ClN3O2S/c1-13-10-11-18(26)19(12-13)31-25-28-22-20-14(2)16(4)32-23(20)27-15(3)21(22)24(30)29(25)17-8-6-5-7-9-17/h5-12H,1-4H3 |
| InChIKey | SKRNEVWTPSUMAK-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |