C27H26N6OS — CID 59755131
6-ethoxy-13-methyl-11-(4-phenylphenyl)-4-piperazin-1-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 59755131) has the molecular formula C27H26N6OS and a molecular weight of 482.61 g/mol. Its IUPAC name is 6-ethoxy-13-methyl-11-(4-phenylphenyl)-4-piperazin-1-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 6-ethoxy-13-methyl-11-(4-phenylphenyl)-4-piperazin-1-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 59755131 |
| Molecular Formula | C27H26N6OS |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 6-ethoxy-13-methyl-11-(4-phenylphenyl)-4-piperazin-1-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(-c3ccc(-c4ccccc4)cc3)nc(C)c12 |
| InChI | InChI=1S/C27H26N6OS/c1-3-34-25-23-22(30-27(32-25)33-15-13-28-14-16-33)21-17(2)29-24(31-26(21)35-23)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h4-12,28H,3,13-16H2,1-2H3 |
| InChIKey | RUKXUNZBRCXOEG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |