C24H32N6OS — CID 11518785
13-ethoxy-15-piperazin-1-yl-8-piperidin-1-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene (PubChem CID 11518785) has the molecular formula C24H32N6OS and a molecular weight of 452.63 g/mol. Its IUPAC name is 13-ethoxy-15-piperazin-1-yl-8-piperidin-1-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene.
| Compound Name | 13-ethoxy-15-piperazin-1-yl-8-piperidin-1-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene |
|---|---|
| PubChem CID | 11518785 |
| Molecular Formula | C24H32N6OS |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 13-ethoxy-15-piperazin-1-yl-8-piperidin-1-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(N3CCCCC3)c3c(c12)CCCC3 |
| InChI | InChI=1S/C24H32N6OS/c1-2-31-22-20-19(26-24(28-22)30-14-10-25-11-15-30)18-16-8-4-5-9-17(16)21(27-23(18)32-20)29-12-6-3-7-13-29/h25H,2-15H2,1H3 |
| InChIKey | YVLNLFPEMYOWOT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |